CAS 2227804-07-9 appears in our catalog under these names: (1S)-1-(2,4,6-trimethylphenyl)ethan-1-amine hydrochloride, 95%, (S)–1–Mesitylethanamine hydrochloride, (1S)-1-(2,4,6-Trimethylphenyl)ethan-1-amine hydrochloride, (1S)-1-(2,4,6-trimethylphenyl)ethan-1-amine hydrochloride, 98%, 98%, (S)-1-Mesitylethanamine hydrochloride, 98%. Offered by: Combi-blocks, GLPBio, Biosynth, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 100mg, 2,5g.
(1S)-1-(2,4,6-trimethylphenyl)ethanamine;hydrochloride (CAS 2227804-07-9) is a chemical compound with the molecular formula C11H18ClN and a molecular weight of 199.72 g/mol. IUPAC name: (1S)-1-(2,4,6-trimethylphenyl)ethanamine;hydrochloride. InChIKey: VFBGENMGPYITQS-PPHPATTJSA-N.
| Molecular formula | C11H18ClN |
|---|---|
| Molecular weight | 199.72 g/mol |
| IUPAC name | (1S)-1-(2,4,6-trimethylphenyl)ethanamine;hydrochloride |
| InChIKey | VFBGENMGPYITQS-PPHPATTJSA-N |
| SMILES | CC1=CC(=C(C(=C1)C)[C@H](C)N)C.Cl |
Computed by PubChem (NCBI)