cas: 133735-64-5 — see every product listed under this CAS number, including other names
(1S,2R)-1-Amino-1-phenylpropan-2-ol hydrochloride, 97% (CAS 133735-64-5) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F544388-50MG |
| cas | 133735-64-5 |
| size | 50mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 50mg | 1257.91 Pln | |
| Fluorochem | 100mg | 1611.95 Pln | |
| Fluorochem | 250mg | 2528.29 Pln | |
| Fluorochem | 1g | 6198.88 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
(1S,2R)-1-amino-1-phenylpropan-2-ol;hydrochloride (CAS 133735-64-5) is a chemical compound with the molecular formula C9H14ClNO and a molecular weight of 187.66 g/mol. IUPAC name: (1S,2R)-1-amino-1-phenylpropan-2-ol;hydrochloride. InChIKey: VIOJYFJDMKDXOT-PRCZDLBKSA-N.
| Molecular formula | C9H14ClNO |
|---|---|
| Molecular weight | 187.66 g/mol |
| IUPAC name | (1S,2R)-1-amino-1-phenylpropan-2-ol;hydrochloride |
| InChIKey | VIOJYFJDMKDXOT-PRCZDLBKSA-N |
| SMILES | C[C@H]([C@H](C1=CC=CC=C1)N)O.Cl |
Computed by PubChem (NCBI)