cas: 2055841-10-4 — see every product listed under this CAS number, including other names
(1S,2R)-Rel-2-(3-ethoxy-4-fluorophenyl)cyclopropan-1-amine hydrochloride, 97%, 97% (CAS 2055841-10-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch113A95-100mg |
| cas | 2055841-10-4 |
| size | 100mg |
| availability | 5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 885.20 Pln | |
| Chemat | 250mg | 1370.00 Pln | |
| Chemat | 500mg | 2234.00 Pln | |
| Chemat | 1g | 3318.80 Pln | |
| Chemat | 5g | 9861.20 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Trans-(1S,2R)-2-(3-ethoxy-4-fluorophenyl)cyclopropan-1-amine;hydrochloride (CAS 2055841-10-4) is a chemical compound with the molecular formula C11H15ClFNO and a molecular weight of 231.69 g/mol. IUPAC name: trans-(1S,2R)-2-(3-ethoxy-4-fluorophenyl)cyclopropan-1-amine;hydrochloride. InChIKey: CHISMAVKDNRNCY-SCYNACPDSA-N.
| Molecular formula | C11H15ClFNO |
|---|---|
| Molecular weight | 231.69 g/mol |
| IUPAC name | trans-(1S,2R)-2-(3-ethoxy-4-fluorophenyl)cyclopropan-1-amine;hydrochloride |
| InChIKey | CHISMAVKDNRNCY-SCYNACPDSA-N |
| SMILES | CCOC1=C(C=CC(=C1)[C@H]2C[C@@H]2N)F.Cl |
Computed by PubChem (NCBI)