cas: 2055841-10-4 — see every product listed under this CAS number, including other names
(1S,2R)-Rel-2-(3-ethoxy-4-fluorophenyl)cyclopropan-1-amine hydrochloride, 97% (CAS 2055841-10-4) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A710978-5g |
| cas | 2055841-10-4 |
| size | 5g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 5g | 24951.22 Pln | |
| AmBeed | 10g | 30178.75 Pln |
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
Trans-(1S,2R)-2-(3-ethoxy-4-fluorophenyl)cyclopropan-1-amine;hydrochloride (CAS 2055841-10-4) is a chemical compound with the molecular formula C11H15ClFNO and a molecular weight of 231.69 g/mol. IUPAC name: trans-(1S,2R)-2-(3-ethoxy-4-fluorophenyl)cyclopropan-1-amine;hydrochloride. InChIKey: CHISMAVKDNRNCY-SCYNACPDSA-N.
| Molecular formula | C11H15ClFNO |
|---|---|
| Molecular weight | 231.69 g/mol |
| IUPAC name | trans-(1S,2R)-2-(3-ethoxy-4-fluorophenyl)cyclopropan-1-amine;hydrochloride |
| InChIKey | CHISMAVKDNRNCY-SCYNACPDSA-N |
| SMILES | CCOC1=C(C=CC(=C1)[C@H]2C[C@@H]2N)F.Cl |
Computed by PubChem (NCBI)