Products 2806362-06-9
CAS 2806362-06-9 is the registry number for 1-(4-Fluoro-3-methylphenyl)-2-(methylamino)-1-propanone Hydrochloride. Offered by: TRC. Available pack sizes: 100mg.
1-(4-fluoro-3-methylphenyl)-2-(methylamino)propan-1-one;hydrochloride (CAS 2806362-06-9) is a chemical compound with the molecular formula C11H15ClFNO and a molecular weight of 231.69 g/mol. IUPAC name: 1-(4-fluoro-3-methylphenyl)-2-(methylamino)propan-1-one;hydrochloride. InChIKey: HZRNDSHOCBDQSD-UHFFFAOYSA-N.
| Molecular formula | C11H15ClFNO |
|---|---|
| Molecular weight | 231.69 g/mol |
| IUPAC name | 1-(4-fluoro-3-methylphenyl)-2-(methylamino)propan-1-one;hydrochloride |
| InChIKey | HZRNDSHOCBDQSD-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)C(=O)C(C)NC)F.Cl |
Computed by PubChem (NCBI)