cas: 69221-14-3 — see every product listed under this CAS number, including other names
(1S,2R,4S,5R)-1-Benzyl-2-(hydroxy(quinolin-4-yl)methyl)-5-vinylquinuclidin-1-ium chloride, 98% (CAS 69221-14-3) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F546464-1G |
| cas | 69221-14-3 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 206.20 Pln | |
| Fluorochem | 5g | 320.74 Pln | |
| Fluorochem | 10g | 591.48 Pln | |
| Fluorochem | 25g | 1377.66 Pln | |
| Fluorochem | 100g | 5308.57 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
(S)-[(2R,4S,5R)-1-benzyl-5-ethenyl-1-azoniabicyclo[2.2.2]octan-2-yl]-quinolin-4-ylmethanol chloride (CAS 69221-14-3) is a chemical compound with the molecular formula C26H29ClN2O and a molecular weight of 421.0 g/mol. IUPAC name: (S)-[(2R,4S,5R)-1-benzyl-5-ethenyl-1-azoniabicyclo[2.2.2]octan-2-yl]-quinolin-4-ylmethanol chloride. InChIKey: FCHYSBWCOKEPNQ-YGNISETGSA-M.
| Molecular formula | C26H29ClN2O |
|---|---|
| Molecular weight | 421.0 g/mol |
| IUPAC name | (S)-[(2R,4S,5R)-1-benzyl-5-ethenyl-1-azoniabicyclo[2.2.2]octan-2-yl]-quinolin-4-ylmethanol chloride |
| InChIKey | FCHYSBWCOKEPNQ-YGNISETGSA-M |
| SMILES | C=C[C@H]1C[N+]2(CC[C@H]1C[C@@H]2[C@H](C3=CC=NC4=CC=CC=C34)O)CC5=CC=CC=C5.[Cl-] |
Computed by PubChem (NCBI)