cas: 69221-14-3 — see every product listed under this CAS number, including other names
N-Benzylcinchonium chloride 98% (CAS 69221-14-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A485474-250mg |
| cas | 69221-14-3 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 203.50 Pln | |
| Ambeed | 1g | 225.75 Pln | |
| Ambeed | 5g | 337.00 Pln | |
| Ambeed | 25g | 1399.44 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A485474 |
(S)-[(2R,4S,5R)-1-benzyl-5-ethenyl-1-azoniabicyclo[2.2.2]octan-2-yl]-quinolin-4-ylmethanol chloride (CAS 69221-14-3) is a chemical compound with the molecular formula C26H29ClN2O and a molecular weight of 421.0 g/mol. IUPAC name: (S)-[(2R,4S,5R)-1-benzyl-5-ethenyl-1-azoniabicyclo[2.2.2]octan-2-yl]-quinolin-4-ylmethanol chloride. InChIKey: FCHYSBWCOKEPNQ-YGNISETGSA-M.
| Molecular formula | C26H29ClN2O |
|---|---|
| Molecular weight | 421.0 g/mol |
| IUPAC name | (S)-[(2R,4S,5R)-1-benzyl-5-ethenyl-1-azoniabicyclo[2.2.2]octan-2-yl]-quinolin-4-ylmethanol chloride |
| InChIKey | FCHYSBWCOKEPNQ-YGNISETGSA-M |
| SMILES | C=C[C@H]1C[N+]2(CC[C@H]1C[C@@H]2[C@H](C3=CC=NC4=CC=CC=C34)O)CC5=CC=CC=C5.[Cl-] |
Computed by PubChem (NCBI)