Cinchonanium, 9-hydroxy-1-(phenylmethyl)-, chloride, (9S)-, 98%, 98%
cas: 69221-14-3 — see every product listed under this CAS number, including other names
Cinchonanium, 9-hydroxy-1-(phenylmethyl)-, chloride, (9S)-, 98%, 98% (CAS 69221-14-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11FCDB-100mg |
| cas | 69221-14-3 |
| size | 100mg |
| availability | 50g |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 98.00 Pln | |
| Chemat | 250mg | 98.00 Pln | |
| Chemat | 1g | 131.60 Pln | |
| Chemat | 5g | 338.00 Pln | |
| Chemat | 10g | 573.20 Pln | |
| Chemat | 25g | 1254.80 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
(S)-[(2R,4S,5R)-1-benzyl-5-ethenyl-1-azoniabicyclo[2.2.2]octan-2-yl]-quinolin-4-ylmethanol chloride (CAS 69221-14-3) is a chemical compound with the molecular formula C26H29ClN2O and a molecular weight of 421.0 g/mol. IUPAC name: (S)-[(2R,4S,5R)-1-benzyl-5-ethenyl-1-azoniabicyclo[2.2.2]octan-2-yl]-quinolin-4-ylmethanol chloride. InChIKey: FCHYSBWCOKEPNQ-YGNISETGSA-M.
| Molecular formula | C26H29ClN2O |
|---|---|
| Molecular weight | 421.0 g/mol |
| IUPAC name | (S)-[(2R,4S,5R)-1-benzyl-5-ethenyl-1-azoniabicyclo[2.2.2]octan-2-yl]-quinolin-4-ylmethanol chloride |
| InChIKey | FCHYSBWCOKEPNQ-YGNISETGSA-M |
| SMILES | C=C[C@H]1C[N+]2(CC[C@H]1C[C@@H]2[C@H](C3=CC=NC4=CC=CC=C34)O)CC5=CC=CC=C5.[Cl-] |
Computed by PubChem (NCBI)