cas: 67333-70-4 — see every product listed under this CAS number, including other names
(1S,2S)-Cyclohexane-1,2-diamine (2S,3S)-2,3-dihydroxysuccinate, 95% (CAS 67333-70-4) is a chemical reagent available from Chemat. Available pack sizes: 10g, 250mg, 25g, 1g, 5g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A592022-10g |
| cas | 67333-70-4 |
| size | 10g |
| availability | USA Stock: 78.25g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 10g | 122.08 Pln | |
| AmBeed | 250mg | 96.04 Pln | |
| AmBeed | 25g | 148.12 Pln | |
| AmBeed | 1g | 101.25 Pln | |
| AmBeed | 5g | 111.66 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
(2S,3S)-2,3-dihydroxybutanedioic acid;trans-(1S,2S)-cyclohexane-1,2-diamine (CAS 67333-70-4) is a chemical compound with the molecular formula C10H20N2O6 and a molecular weight of 264.28 g/mol. IUPAC name: (2S,3S)-2,3-dihydroxybutanedioic acid;trans-(1S,2S)-cyclohexane-1,2-diamine. InChIKey: GDOTUTAQOJUZOF-SCDVTJNCSA-N.
| Molecular formula | C10H20N2O6 |
|---|---|
| Molecular weight | 264.28 g/mol |
| IUPAC name | (2S,3S)-2,3-dihydroxybutanedioic acid;trans-(1S,2S)-cyclohexane-1,2-diamine |
| InChIKey | GDOTUTAQOJUZOF-SCDVTJNCSA-N |
| SMILES | C1CC[C@@H]([C@H](C1)N)N.[C@H]([C@@H](C(=O)O)O)(C(=O)O)O |
Computed by PubChem (NCBI)