cas: 67333-70-4 — see every product listed under this CAS number, including other names
(S,S)-(-)-1,2-Diaminocyclohexane-D-Tartrate, 95% (CAS 67333-70-4) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g, 10g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F012715-1G |
| cas | 67333-70-4 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 81.24 Pln | |
| Fluorochem | 5g | 96.86 Pln | |
| Fluorochem | 25g | 133.30 Pln | |
| Fluorochem | 10g | 133.30 Pln | |
| Fluorochem | 100g | 362.39 Pln |
| delivery time | 2-3 weeks |
|---|---|
| purity | 95% |
(2S,3S)-2,3-dihydroxybutanedioic acid;trans-(1S,2S)-cyclohexane-1,2-diamine (CAS 67333-70-4) is a chemical compound with the molecular formula C10H20N2O6 and a molecular weight of 264.28 g/mol. IUPAC name: (2S,3S)-2,3-dihydroxybutanedioic acid;trans-(1S,2S)-cyclohexane-1,2-diamine. InChIKey: GDOTUTAQOJUZOF-SCDVTJNCSA-N.
| Molecular formula | C10H20N2O6 |
|---|---|
| Molecular weight | 264.28 g/mol |
| IUPAC name | (2S,3S)-2,3-dihydroxybutanedioic acid;trans-(1S,2S)-cyclohexane-1,2-diamine |
| InChIKey | GDOTUTAQOJUZOF-SCDVTJNCSA-N |
| SMILES | C1CC[C@@H]([C@H](C1)N)N.[C@H]([C@@H](C(=O)O)O)(C(=O)O)O |
Computed by PubChem (NCBI)