cas: 222530-34-9 — see every product listed under this CAS number, including other names
(1S,3R)-3-[[(tert-Butoxy)carbonyl]amino]cyclohexanecarboxylic acid, 97%, 97% (CAS 222530-34-9) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g, 100mg, 250mg, 1g, 50g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1148TD-5g |
| cas | 222530-34-9 |
| size | 5g |
| availability | 100g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 5g | 338.00 Pln | |
| Chemat | 10g | 578.00 Pln | |
| Chemat | 25g | 1302.80 Pln | |
| Chemat | 100mg | 78.80 Pln | |
| Chemat | 250mg | 83.60 Pln | |
| Chemat | 1g | 131.60 Pln | |
| Chemat | 50g | 2128.40 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Cis-(1S,3R)-3-[(2-methylpropan-2-yl)oxycarbonylamino]cyclohexane-1-carboxylic acid (CAS 222530-34-9) is a chemical compound with the molecular formula C12H21NO4 and a molecular weight of 243.30 g/mol. IUPAC name: cis-(1S,3R)-3-[(2-methylpropan-2-yl)oxycarbonylamino]cyclohexane-1-carboxylic acid. InChIKey: JSGHMGKJNZTKGF-DTWKUNHWSA-N.
| Molecular formula | C12H21NO4 |
|---|---|
| Molecular weight | 243.30 g/mol |
| IUPAC name | cis-(1S,3R)-3-[(2-methylpropan-2-yl)oxycarbonylamino]cyclohexane-1-carboxylic acid |
| InChIKey | JSGHMGKJNZTKGF-DTWKUNHWSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H]1CCC[C@@H](C1)C(=O)O |
Computed by PubChem (NCBI)