cas: 1392745-59-3 — see every product listed under this CAS number, including other names
(1S,3R,4R)-Ethyl 4-amino-3-((tert-butoxycarbonyl)amino)cyclohexanecarboxylate 95% (CAS 1392745-59-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A278036-100mg |
| cas | 1392745-59-3 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 915.50 Pln | |
| Ambeed | 250mg | 1505.12 Pln | |
| Ambeed | 1g | 3652.25 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A278036 |
Ethyl (1S,3R,4R)-4-amino-3-[(2-methylpropan-2-yl)oxycarbonylamino]cyclohexane-1-carboxylate (CAS 1392745-59-3) is a chemical compound with the molecular formula C14H26N2O4 and a molecular weight of 286.37 g/mol. IUPAC name: ethyl (1S,3R,4R)-4-amino-3-[(2-methylpropan-2-yl)oxycarbonylamino]cyclohexane-1-carboxylate. InChIKey: STWAQGKVYHZJCJ-HBNTYKKESA-N.
| Molecular formula | C14H26N2O4 |
|---|---|
| Molecular weight | 286.37 g/mol |
| IUPAC name | ethyl (1S,3R,4R)-4-amino-3-[(2-methylpropan-2-yl)oxycarbonylamino]cyclohexane-1-carboxylate |
| InChIKey | STWAQGKVYHZJCJ-HBNTYKKESA-N |
| SMILES | CCOC(=O)[C@H]1CC[C@H]([C@@H](C1)NC(=O)OC(C)(C)C)N |
Computed by PubChem (NCBI)