CAS 76535-75-6 appears in our catalog under these names: 1,4-Di-tert-butyl piperazine-1,4-dicarboxylate, 98%, N,N-Di-Boc-Piperazine, 1,4–Di–tert–butyl piperazine–1,4–dicarboxylate, Di-tert-butyl piperazine-1,4-dicarboxylate, 98%, 98%, Di-tert-butyl piperazine-1,4-dicarboxylate, 95%. Offered by: Combi-blocks, Chemat Brand, GLPBio, Chemat, Fluorochem. Available pack sizes: 10g, 25g, 100g, 5g, 1g, on request, 250mg, 500g.
Ditert-butyl piperazine-1,4-dicarboxylate (CAS 76535-75-6) is a chemical compound with the molecular formula C14H26N2O4 and a molecular weight of 286.37 g/mol. IUPAC name: ditert-butyl piperazine-1,4-dicarboxylate. InChIKey: YROXEBCFDJQGOH-UHFFFAOYSA-N.
| Molecular formula | C14H26N2O4 |
|---|---|
| Molecular weight | 286.37 g/mol |
| IUPAC name | ditert-butyl piperazine-1,4-dicarboxylate |
| InChIKey | YROXEBCFDJQGOH-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCN(CC1)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)