CAS 1016258-69-7 appears in our catalog under these names: 1-tert-Butyl 4-ethyl 4-(aminomethyl)piperidine-1,4-dicarboxylate, 95%, 1–tert–Butyl 4–ethyl 4–(aminomethyl)piperidine–1,4–dicarboxylate, 1-tert-Butyl 4-ethyl 4-(aminomethyl)piperidine-1,4-dicarboxylate, 97%, 97%, 1-tert-Butyl 4-ethyl 4-(aminomethyl)piperidine-1,4-dicarboxylate, 97%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 5g, 10g, 250mg, 1g, 50mg, 100mg, 500mg, 25g.
1-O-tert-butyl 4-O-ethyl 4-(aminomethyl)piperidine-1,4-dicarboxylate (CAS 1016258-69-7) is a chemical compound with the molecular formula C14H26N2O4 and a molecular weight of 286.37 g/mol. IUPAC name: 1-O-tert-butyl 4-O-ethyl 4-(aminomethyl)piperidine-1,4-dicarboxylate. InChIKey: UHHUEAGCENEXAJ-UHFFFAOYSA-N.
| Molecular formula | C14H26N2O4 |
|---|---|
| Molecular weight | 286.37 g/mol |
| IUPAC name | 1-O-tert-butyl 4-O-ethyl 4-(aminomethyl)piperidine-1,4-dicarboxylate |
| InChIKey | UHHUEAGCENEXAJ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1(CCN(CC1)C(=O)OC(C)(C)C)CN |
Computed by PubChem (NCBI)