(1S,3aR,6aS)-2-(Tert-Butoxycarbonyl)Octahydrocyclopenta[C]Pyrrole-1-Carboxylic Acid, 95+%
cas: 597569-42-1 — see every product listed under this CAS number, including other names
(1S,3aR,6aS)-2-(Tert-Butoxycarbonyl)Octahydrocyclopenta[C]Pyrrole-1-Carboxylic Acid, 95+% (CAS 597569-42-1) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g, 5g, 10g. Offered by: Chemat, Fluorochem.
| brand | Chemat |
|---|---|
| catalog number | Ch11E0LM-50mg |
| cas | 597569-42-1 |
| size | 50mg |
| availability | 35g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 50mg | 362.00 Pln | |
| Chemat | 100mg | 510.80 Pln | |
| Chemat | 250mg | 741.20 Pln | |
| Chemat | 1g | 1571.60 Pln | |
| Chemat | 5g | 4926.80 Pln | |
| Fluorochem | 100mg | 679.99 Pln | |
| Fluorochem | 250mg | 1018.41 Pln | |
| Fluorochem | 1g | 1976.41 Pln | |
| Fluorochem | 5g | 6604.98 Pln | |
| Fluorochem | 10g | 10541.10 Pln |
properties
| purity | 95+% |
|---|---|
| delivery time | 3 weeks |
(3S,3aS,6aR)-2-[(2-methylpropan-2-yl)oxycarbonyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-3-carboxylic acid (CAS 597569-42-1) is a chemical compound with the molecular formula C13H21NO4 and a molecular weight of 255.31 g/mol. IUPAC name: (3S,3aS,6aR)-2-[(2-methylpropan-2-yl)oxycarbonyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-3-carboxylic acid. InChIKey: SFBZDQKMJLUZQF-GUBZILKMSA-N.
| Molecular formula | C13H21NO4 |
|---|---|
| Molecular weight | 255.31 g/mol |
| IUPAC name | (3S,3aS,6aR)-2-[(2-methylpropan-2-yl)oxycarbonyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-3-carboxylic acid |
| InChIKey | SFBZDQKMJLUZQF-GUBZILKMSA-N |
| SMILES | CC(C)(C)OC(=O)N1C[C@@H]2CCC[C@@H]2[C@H]1C(=O)O |
Computed by PubChem (NCBI)