Products 179236-78-3

CAS 179236-78-3 is the registry number for 3-tert-Butyl 6-ethyl 3-azabicyclo[3.1.0]hexane-3,6-dicarboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.

Structural formula: {0} (CAS {1})

3-O-tert-butyl 6-O-ethyl 3-azabicyclo[3.1.0]hexane-3,6-dicarboxylate (CAS 179236-78-3) is a chemical compound with the molecular formula C13H21NO4 and a molecular weight of 255.31 g/mol. IUPAC name: 3-O-tert-butyl 6-O-ethyl 3-azabicyclo[3.1.0]hexane-3,6-dicarboxylate. InChIKey: SESCEXYKMJZFEE-UHFFFAOYSA-N.

Identity
Molecular formulaC13H21NO4
Molecular weight255.31 g/mol
IUPAC name3-O-tert-butyl 6-O-ethyl 3-azabicyclo[3.1.0]hexane-3,6-dicarboxylate
InChIKeySESCEXYKMJZFEE-UHFFFAOYSA-N
SMILESCCOC(=O)C1C2C1CN(C2)C(=O)OC(C)(C)C

Computed by PubChem (NCBI)