CAS 197080-73-2 appears in our catalog under these names: Endo-7-tert-butyl 2-methyl 7-azabicyclo[2.2.1]heptane-2,7-dicarboxylate, 95%, 7-(tert-Butyl) 2-methyl rel-(1R,2R,4S)-7-azabicyclo[2.2.1]heptane-2,7-dicarboxylate 97%, ENDO-7-TERT-BUTYL 2-METHYL 7-AZABICYCLO[2.2.1]HEPTANE-2,7-DICARBOXYLATE, 95%, 95%. Offered by: Combi-blocks, Ambeed, Chemat. Available pack sizes: 1g, 100mg, 250mg.
7-O-tert-butyl 2-O-methyl (1S,2S,4R)-7-azabicyclo[2.2.1]heptane-2,7-dicarboxylate (CAS 197080-73-2) is a chemical compound with the molecular formula C13H21NO4 and a molecular weight of 255.31 g/mol. IUPAC name: 7-O-tert-butyl 2-O-methyl (1S,2S,4R)-7-azabicyclo[2.2.1]heptane-2,7-dicarboxylate. InChIKey: ZBESKVIRYNQXCD-UTLUCORTSA-N.
| Molecular formula | C13H21NO4 |
|---|---|
| Molecular weight | 255.31 g/mol |
| IUPAC name | 7-O-tert-butyl 2-O-methyl (1S,2S,4R)-7-azabicyclo[2.2.1]heptane-2,7-dicarboxylate |
| InChIKey | ZBESKVIRYNQXCD-UTLUCORTSA-N |
| SMILES | CC(C)(C)OC(=O)N1[C@@H]2CC[C@H]1[C@H](C2)C(=O)OC |
Computed by PubChem (NCBI)