cas: 198835-01-7 — see every product listed under this CAS number, including other names
(1S,4R,6S)-TERT-BUTYL 6-HYDROXY-2-AZABICYCLO[2.2.1]HEPTANE-2-CARBOXYLATE, 96% (CAS 198835-01-7) is a chemical reagent available from Chemat. Available pack sizes: 25mg, 50mg, 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F532333-25MG |
| cas | 198835-01-7 |
| size | 25mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 25mg | 476.93 Pln | |
| Fluorochem | 50mg | 763.29 Pln | |
| Fluorochem | 100mg | 1237.08 Pln | |
| Fluorochem | 250mg | 1950.37 Pln | |
| Fluorochem | 1g | 4793.12 Pln |
| purity | 96% |
|---|---|
| delivery time | 3-4 weeks |
Tert-butyl (1S,4R,6S)-6-hydroxy-2-azabicyclo[2.2.1]heptane-2-carboxylate (CAS 198835-01-7) is a chemical compound with the molecular formula C11H19NO3 and a molecular weight of 213.27 g/mol. IUPAC name: tert-butyl (1S,4R,6S)-6-hydroxy-2-azabicyclo[2.2.1]heptane-2-carboxylate. InChIKey: PABFVGKPNHVSCG-VGMNWLOBSA-N.
| Molecular formula | C11H19NO3 |
|---|---|
| Molecular weight | 213.27 g/mol |
| IUPAC name | tert-butyl (1S,4R,6S)-6-hydroxy-2-azabicyclo[2.2.1]heptane-2-carboxylate |
| InChIKey | PABFVGKPNHVSCG-VGMNWLOBSA-N |
| SMILES | CC(C)(C)OC(=O)N1C[C@@H]2C[C@H]1[C@H](C2)O |
Computed by PubChem (NCBI)