CAS 1893407-98-1 is the registry number for tert-butyl (1R,4S,6S)-6-hydroxy-2-azabicyclo(2.2.1)heptane-2-carboxylate, 97%. Offered by: AmBeed. Available pack sizes: 5g, 1g.
Tert-butyl (1R,4S,6S)-6-hydroxy-2-azabicyclo[2.2.1]heptane-2-carboxylate (CAS 1893407-98-1) is a chemical compound with the molecular formula C11H19NO3 and a molecular weight of 213.27 g/mol. IUPAC name: tert-butyl (1R,4S,6S)-6-hydroxy-2-azabicyclo[2.2.1]heptane-2-carboxylate. InChIKey: PABFVGKPNHVSCG-YIZRAAEISA-N.
| Molecular formula | C11H19NO3 |
|---|---|
| Molecular weight | 213.27 g/mol |
| IUPAC name | tert-butyl (1R,4S,6S)-6-hydroxy-2-azabicyclo[2.2.1]heptane-2-carboxylate |
| InChIKey | PABFVGKPNHVSCG-YIZRAAEISA-N |
| SMILES | CC(C)(C)OC(=O)N1C[C@H]2C[C@@H]1[C@H](C2)O |
Computed by PubChem (NCBI)