cas: 489-39-4 — see every product listed under this CAS number, including other names
(1aR,4aR,7R,7aR,7bS)-Decahydro-1,1,7-trimethyl-4-methylene-1H-cycloprop[e]azulene, 96%, 96% (CAS 489-39-4) is a chemical reagent available from Chemat. Available pack sizes: 5mg, 25mg, 100mg, 500mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114BCB-5mg |
| cas | 489-39-4 |
| size | 5mg |
| availability | 3g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 5mg | 251.60 Pln | |
| Chemat | 25mg | 458.00 Pln | |
| Chemat | 100mg | 846.80 Pln | |
| Chemat | 500mg | 2555.60 Pln | |
| Chemat | 1g | 4619.60 Pln |
| purity | 96% |
|---|---|
| delivery time | 3 weeks |
(1aR,4aR,7R,7aR,7bS)-1,1,7-trimethyl-4-methylidene-2,3,4a,5,6,7,7a,7b-octahydro-1aH-cyclopropa[e]azulene (CAS 489-39-4) is a chemical compound with the molecular formula C15H24 and a molecular weight of 204.35 g/mol. IUPAC name: (1aR,4aR,7R,7aR,7bS)-1,1,7-trimethyl-4-methylidene-2,3,4a,5,6,7,7a,7b-octahydro-1aH-cyclopropa[e]azulene. InChIKey: ITYNGVSTWVVPIC-XVIXHAIJSA-N.
| Molecular formula | C15H24 |
|---|---|
| Molecular weight | 204.35 g/mol |
| IUPAC name | (1aR,4aR,7R,7aR,7bS)-1,1,7-trimethyl-4-methylidene-2,3,4a,5,6,7,7a,7b-octahydro-1aH-cyclopropa[e]azulene |
| InChIKey | ITYNGVSTWVVPIC-XVIXHAIJSA-N |
| SMILES | C[C@@H]1CC[C@@H]2[C@@H]1[C@H]3[C@H](C3(C)C)CCC2=C |
Computed by PubChem (NCBI)