CAS 495-62-5 appears in our catalog under these names: Bisabolene, 95%, gamma-Bisabolene (Mixture of Isomers) (Technical Grade), Bisabolene, 95+%, 4–(1,5–Dimethyl–4–hexenylidene)–1–methyl–cyclohexen, Bisabolene, mixture of isomers . Offered by: Combi-blocks, TRC, AmBeed, GLPBio, Thermo Scientific (Alfa Aesar). Available pack sizes: 10g, 25g, 1g, 5g, 100mg, 500mg, 50g, 100g.
1-methyl-4-(6-methylhept-5-en-2-ylidene)cyclohexene (CAS 495-62-5) is a chemical compound with the molecular formula C15H24 and a molecular weight of 204.35 g/mol. IUPAC name: 1-methyl-4-(6-methylhept-5-en-2-ylidene)cyclohexene. InChIKey: XBGUIVFBMBVUEG-UHFFFAOYSA-N.
| Molecular formula | C15H24 |
|---|---|
| Molecular weight | 204.35 g/mol |
| IUPAC name | 1-methyl-4-(6-methylhept-5-en-2-ylidene)cyclohexene |
| InChIKey | XBGUIVFBMBVUEG-UHFFFAOYSA-N |
| SMILES | CC1=CCC(=C(C)CCC=C(C)C)CC1 |
Computed by PubChem (NCBI)