CAS 489-39-4 appears in our catalog under these names: (+)-Aromadendrene, min. 80 %, 5 g, (+)-Aromadendrene, 95%, (+)-Aromadendrene, >95% (GC), Aromadendrene, (+)-Aromadendrene. Offered by: Roth, Combi-blocks, TRC, GLPBio, TargetMol. Available pack sizes: 5g, 1g, 10mg, 50mg, 5mg, 25mg, 100mg, 0,5g.
(1aR,4aR,7R,7aR,7bS)-1,1,7-trimethyl-4-methylidene-2,3,4a,5,6,7,7a,7b-octahydro-1aH-cyclopropa[e]azulene (CAS 489-39-4) is a chemical compound with the molecular formula C15H24 and a molecular weight of 204.35 g/mol. IUPAC name: (1aR,4aR,7R,7aR,7bS)-1,1,7-trimethyl-4-methylidene-2,3,4a,5,6,7,7a,7b-octahydro-1aH-cyclopropa[e]azulene. InChIKey: ITYNGVSTWVVPIC-XVIXHAIJSA-N.
| Molecular formula | C15H24 |
|---|---|
| Molecular weight | 204.35 g/mol |
| IUPAC name | (1aR,4aR,7R,7aR,7bS)-1,1,7-trimethyl-4-methylidene-2,3,4a,5,6,7,7a,7b-octahydro-1aH-cyclopropa[e]azulene |
| InChIKey | ITYNGVSTWVVPIC-XVIXHAIJSA-N |
| SMILES | C[C@@H]1CC[C@@H]2[C@@H]1[C@H]3[C@H](C3(C)C)CCC2=C |
Computed by PubChem (NCBI)