cas: 1383531-49-4 — see every product listed under this CAS number, including other names
(2'-Fluoro-[1,1'-biphenyl]-4-yl)boronic acid 95% (CAS 1383531-49-4) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A378370-50mg |
| cas | 1383531-49-4 |
| size | 50mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 50mg | 1165.81 Pln | |
| Ambeed | 100mg | 1699.81 Pln | |
| Ambeed | 250mg | 2417.38 Pln | |
| Ambeed | 1g | 4686.88 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A378370 |
[4-(2-fluorophenyl)phenyl]boronic acid (CAS 1383531-49-4) is a chemical compound with the molecular formula C12H10BFO2 and a molecular weight of 216.02 g/mol. IUPAC name: [4-(2-fluorophenyl)phenyl]boronic acid. InChIKey: VXZNXBXQOLYKSL-UHFFFAOYSA-N.
| Molecular formula | C12H10BFO2 |
|---|---|
| Molecular weight | 216.02 g/mol |
| IUPAC name | [4-(2-fluorophenyl)phenyl]boronic acid |
| InChIKey | VXZNXBXQOLYKSL-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)C2=CC=CC=C2F)(O)O |
Computed by PubChem (NCBI)