Products 178305-99-2
CAS 178305-99-2 appears in our catalog under these names: 2–Fluoro–4–biphenylylboronic acid, 2-Fluorobiphenyl-4-ylboronic acid, 98%, 2-Fluoro-4-biphenylylboronic acid, 98%, 2-Fluoro-4-Biphenylylboronic Acid, 98%, 98%, 2-Fluoro-4-biphenylboronic Acid (contains varying amounts of Anhydride). Offered by: GLPBio, Combi-blocks, Fluorochem, Ambeed, Chemat. Available pack sizes: 5g, 25g, 100g, 1g.
(3-fluoro-4-phenylphenyl)boronic acid (CAS 178305-99-2) is a chemical compound with the molecular formula C12H10BFO2 and a molecular weight of 216.02 g/mol. IUPAC name: (3-fluoro-4-phenylphenyl)boronic acid. InChIKey: BWYWXDFYJSIUBE-UHFFFAOYSA-N.
| Molecular formula | C12H10BFO2 |
|---|---|
| Molecular weight | 216.02 g/mol |
| IUPAC name | (3-fluoro-4-phenylphenyl)boronic acid |
| InChIKey | BWYWXDFYJSIUBE-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1)C2=CC=CC=C2)F)(O)O |
Computed by PubChem (NCBI)
Synonyms:
2-Fluoro-4-biphenylboronic Acid, 2-Fluoro-4-biphenylylboronic acid, 2-Fluorobiphenyl-4-boronic acid, (3-fluoro-4-phenylphenyl)boronic acid, 2-fluorobiphenyl-4-ylboronic acid, Boronic acid, B-(2-fluoro[1,1'-biphenyl]-4-yl)-, (2-fluoro-[1,1'-biphenyl]-4-yl)boronic acid, Boronic acid, (2-fluoro[1,1'-biphenyl]-4-yl)-, 3-Fluoro-4-phenylbenzeneboronic Acid, 2-Fluoro-biphenyl-4-boronic acid