cas: 1383531-49-4 — see every product listed under this CAS number, including other names
(2'-Fluoro-[1,1'-biphenyl]-4-yl)boronic acid, 95% (CAS 1383531-49-4) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F545296-50MG |
| cas | 1383531-49-4 |
| size | 50mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 50mg | 1637.98 Pln | |
| Fluorochem | 100mg | 2262.76 Pln | |
| Fluorochem | 250mg | 3361.33 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
[4-(2-fluorophenyl)phenyl]boronic acid (CAS 1383531-49-4) is a chemical compound with the molecular formula C12H10BFO2 and a molecular weight of 216.02 g/mol. IUPAC name: [4-(2-fluorophenyl)phenyl]boronic acid. InChIKey: VXZNXBXQOLYKSL-UHFFFAOYSA-N.
| Molecular formula | C12H10BFO2 |
|---|---|
| Molecular weight | 216.02 g/mol |
| IUPAC name | [4-(2-fluorophenyl)phenyl]boronic acid |
| InChIKey | VXZNXBXQOLYKSL-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)C2=CC=CC=C2F)(O)O |
Computed by PubChem (NCBI)