cas: 191529-08-5 — see every product listed under this CAS number, including other names
(2,4,6-Tribromobenzene-1,3,5-triyl)trimethanol, 95%, 95% (CAS 191529-08-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch113FAY-100mg |
| cas | 191529-08-5 |
| size | 100mg |
| availability | 9g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 232.40 Pln | |
| Chemat | 250mg | 328.40 Pln | |
| Chemat | 1g | 1067.60 Pln | |
| Chemat | 5g | 3923.60 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
[2,4,6-tribromo-3,5-bis(hydroxymethyl)phenyl]methanol (CAS 191529-08-5) is a chemical compound with the molecular formula C9H9Br3O3 and a molecular weight of 404.88 g/mol. IUPAC name: [2,4,6-tribromo-3,5-bis(hydroxymethyl)phenyl]methanol. InChIKey: DNTYGIFJYSSHRM-UHFFFAOYSA-N.
| Molecular formula | C9H9Br3O3 |
|---|---|
| Molecular weight | 404.88 g/mol |
| IUPAC name | [2,4,6-tribromo-3,5-bis(hydroxymethyl)phenyl]methanol |
| InChIKey | DNTYGIFJYSSHRM-UHFFFAOYSA-N |
| SMILES | C(C1=C(C(=C(C(=C1Br)CO)Br)CO)Br)O |
Computed by PubChem (NCBI)