CAS 191529-08-5 appears in our catalog under these names: (2,4,6-Tribromobenzene-1,3,5-triyl)trimethanol, 95%, (2,4,6–Tribromobenzene–1,3,5–triyl)trimethanol, (2,4,6-Tribromobenzene-1,3,5-triyl)trimethanol, 95%, 95%, (2,4,6-Tribromobenzene-1,3,5-triyl)trimethanol, 97%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 5g, 250mg, 1g, 100mg.
[2,4,6-tribromo-3,5-bis(hydroxymethyl)phenyl]methanol (CAS 191529-08-5) is a chemical compound with the molecular formula C9H9Br3O3 and a molecular weight of 404.88 g/mol. IUPAC name: [2,4,6-tribromo-3,5-bis(hydroxymethyl)phenyl]methanol. InChIKey: DNTYGIFJYSSHRM-UHFFFAOYSA-N.
| Molecular formula | C9H9Br3O3 |
|---|---|
| Molecular weight | 404.88 g/mol |
| IUPAC name | [2,4,6-tribromo-3,5-bis(hydroxymethyl)phenyl]methanol |
| InChIKey | DNTYGIFJYSSHRM-UHFFFAOYSA-N |
| SMILES | C(C1=C(C(=C(C(=C1Br)CO)Br)CO)Br)O |
Computed by PubChem (NCBI)