CAS 105404-90-8 appears in our catalog under these names: 1,3,5-Tribromo-2,4,6-trimethoxybenzene, 95%, 95%, 1,3,5-Tribromo-2,4,6-trimethoxybenzene, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
1,3,5-tribromo-2,4,6-trimethoxybenzene (CAS 105404-90-8) is a chemical compound with the molecular formula C9H9Br3O3 and a molecular weight of 404.88 g/mol. IUPAC name: 1,3,5-tribromo-2,4,6-trimethoxybenzene. InChIKey: ADAADQHCXJGTIM-UHFFFAOYSA-N.
| Molecular formula | C9H9Br3O3 |
|---|---|
| Molecular weight | 404.88 g/mol |
| IUPAC name | 1,3,5-tribromo-2,4,6-trimethoxybenzene |
| InChIKey | ADAADQHCXJGTIM-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=C(C(=C1Br)OC)Br)OC)Br |
Computed by PubChem (NCBI)