(2,4,6-Triisopropylphenyl)boronic acid, 98%
cas: 154549-38-9 — see every product listed under this CAS number, including other names
(2,4,6-Triisopropylphenyl)boronic acid, 98% (CAS 154549-38-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g, 500g. Offered by: Ambeed, Chemat.
| brand | Ambeed |
|---|---|
| catalog number | A232829-250mg |
| cas | 154549-38-9 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 125.62 Pln | |
| Ambeed | 1g | 131.19 Pln | |
| Ambeed | 5g | 175.69 Pln | |
| Ambeed | 10g | 275.81 Pln | |
| Ambeed | 25g | 364.81 Pln | |
| Ambeed | 100g | 1071.25 Pln | |
| Chemat | 250mg | 74.00 Pln | |
| Chemat | 1g | 78.80 Pln | |
| Chemat | 5g | 107.60 Pln | |
| Chemat | 10g | 150.80 Pln | |
| Chemat | 25g | 280.40 Pln | |
| Chemat | 100g | 890.00 Pln | |
| Chemat | 500g | 4276.80 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
[2,4,6-tri(propan-2-yl)phenyl]boronic acid (CAS 154549-38-9) is a chemical compound with the molecular formula C15H25BO2 and a molecular weight of 248.17 g/mol. IUPAC name: [2,4,6-tri(propan-2-yl)phenyl]boronic acid. InChIKey: FGFYEKLWZBTLEW-UHFFFAOYSA-N.
| Molecular formula | C15H25BO2 |
|---|---|
| Molecular weight | 248.17 g/mol |
| IUPAC name | [2,4,6-tri(propan-2-yl)phenyl]boronic acid |
| InChIKey | FGFYEKLWZBTLEW-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=C(C=C1C(C)C)C(C)C)C(C)C)(O)O |
Computed by PubChem (NCBI)
Synonyms:
[2,4,6-Tri(propan-2-yl)phenyl]boronic acid, (2,4,6-Tri(propan-2-yl)phenyl)boronic acid, (2,4,6-Triisopropylphenyl)boronic acid, 2,4,6-triisopropylphenylboronic acid, 2,4,6-Triisopropylbenzeneboronic Acid, [2,4,6-tris(propan-2-yl)phenyl]boronic acid, (2,4,6-Triisopropylphenyl)boronicacid, 2,4,6-triisopropylphenyiboronic acid, 2,4,6-triisopropylphenylboronic ac, 2,4,6-Triisopropylbenzeneboronic Acid (contains varying amounts of Anhydride)