cas: 870778-96-4 — see every product listed under this CAS number, including other names
(2,4-Dibromo-6-fluorophenyl)boronic acid 98% (CAS 870778-96-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A180031-250mg |
| cas | 870778-96-4 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 147.88 Pln | |
| Ambeed | 1g | 164.56 Pln | |
| Ambeed | 5g | 448.25 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A180031 |
(2,4-dibromo-6-fluorophenyl)boronic acid (CAS 870778-96-4) is a chemical compound with the molecular formula C6H4BBr2FO2 and a molecular weight of 297.71 g/mol. IUPAC name: (2,4-dibromo-6-fluorophenyl)boronic acid. InChIKey: HZNUDGYZJPJQTD-UHFFFAOYSA-N.
| Molecular formula | C6H4BBr2FO2 |
|---|---|
| Molecular weight | 297.71 g/mol |
| IUPAC name | (2,4-dibromo-6-fluorophenyl)boronic acid |
| InChIKey | HZNUDGYZJPJQTD-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=C(C=C1Br)Br)F)(O)O |
Computed by PubChem (NCBI)