Products 870778-96-4

CAS 870778-96-4 appears in our catalog under these names: 2,4-Dibromo-6-fluorophenylboronic acid, 98%, (2,4-Dibromo-6-fluorophenyl)boronic acid 98%, 2,4-Dibromo-6-fluorophenylboronic acid, 98%, 98%, (2,4-Dibromo-6-fluorophenyl)boronic acid. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 250mg, 10g.

Structural formula: {0} (CAS {1})

(2,4-dibromo-6-fluorophenyl)boronic acid (CAS 870778-96-4) is a chemical compound with the molecular formula C6H4BBr2FO2 and a molecular weight of 297.71 g/mol. IUPAC name: (2,4-dibromo-6-fluorophenyl)boronic acid. InChIKey: HZNUDGYZJPJQTD-UHFFFAOYSA-N.

Identity
Molecular formulaC6H4BBr2FO2
Molecular weight297.71 g/mol
IUPAC name(2,4-dibromo-6-fluorophenyl)boronic acid
InChIKeyHZNUDGYZJPJQTD-UHFFFAOYSA-N
SMILESB(C1=C(C=C(C=C1Br)Br)F)(O)O

Computed by PubChem (NCBI)