Products 1072951-82-6

CAS 1072951-82-6 appears in our catalog under these names: 3,5-Dibromo-2-fluorophenylboronic acid, 96%, (3,5-Dibromo-2-fluorophenyl)boronic acid 95%, 3,5-Dibromo-2-fluorophenylboronic acid, 95%, 95%, (3,5-Dibromo-2-fluorophenyl)boronic acid, 95%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 25g, 5g, 250mg.

Structural formula: {0} (CAS {1})

(3,5-dibromo-2-fluorophenyl)boronic acid (CAS 1072951-82-6) is a chemical compound with the molecular formula C6H4BBr2FO2 and a molecular weight of 297.71 g/mol. IUPAC name: (3,5-dibromo-2-fluorophenyl)boronic acid. InChIKey: IOOXXDZRFJBCLR-UHFFFAOYSA-N.

Identity
Molecular formulaC6H4BBr2FO2
Molecular weight297.71 g/mol
IUPAC name(3,5-dibromo-2-fluorophenyl)boronic acid
InChIKeyIOOXXDZRFJBCLR-UHFFFAOYSA-N
SMILESB(C1=CC(=CC(=C1F)Br)Br)(O)O

Computed by PubChem (NCBI)