cas: 462059-71-8 — see every product listed under this CAS number, including other names
(2,4-Dimethoxybenzyl)hydrazine hydrochloride, 96% (CAS 462059-71-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F470625-100MG |
| cas | 462059-71-8 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 372.80 Pln | |
| Fluorochem | 250mg | 591.48 Pln | |
| Fluorochem | 1g | 1231.88 Pln | |
| Fluorochem | 5g | 3673.72 Pln | |
| Fluorochem | 10g | 6110.37 Pln |
| purity | 96% |
|---|---|
| delivery time | 3-4 weeks |
(2,4-dimethoxyphenyl)methylhydrazine;hydrochloride (CAS 462059-71-8) is a chemical compound with the molecular formula C9H15ClN2O2 and a molecular weight of 218.68 g/mol. IUPAC name: (2,4-dimethoxyphenyl)methylhydrazine;hydrochloride. InChIKey: JCIAZIMKVLPKFW-UHFFFAOYSA-N.
| Molecular formula | C9H15ClN2O2 |
|---|---|
| Molecular weight | 218.68 g/mol |
| IUPAC name | (2,4-dimethoxyphenyl)methylhydrazine;hydrochloride |
| InChIKey | JCIAZIMKVLPKFW-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C=C1)CNN)OC.Cl |
Computed by PubChem (NCBI)