Products 1016506-44-7
CAS 1016506-44-7 appears in our catalog under these names: 1-(2-Chloropropanoyl)piperidine-3-carboxamide, 95%, 1-(2-Chloropropanoyl)piperidine-3-carboxamide. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 2,5g.
1-(2-chloropropanoyl)piperidine-3-carboxamide (CAS 1016506-44-7) is a chemical compound with the molecular formula C9H15ClN2O2 and a molecular weight of 218.68 g/mol. IUPAC name: 1-(2-chloropropanoyl)piperidine-3-carboxamide. InChIKey: CWSRTEPZYFRXCX-UHFFFAOYSA-N.
| Molecular formula | C9H15ClN2O2 |
|---|---|
| Molecular weight | 218.68 g/mol |
| IUPAC name | 1-(2-chloropropanoyl)piperidine-3-carboxamide |
| InChIKey | CWSRTEPZYFRXCX-UHFFFAOYSA-N |
| SMILES | CC(C(=O)N1CCCC(C1)C(=O)N)Cl |
Computed by PubChem (NCBI)