Products 462059-71-8

CAS 462059-71-8 appears in our catalog under these names: (2,4-Dimethoxybenzyl)hydrazine hydrochloride, 95%, (2,4-dimethoxybenzyl)hydrazine hcl, (2,4-Dimethoxybenzyl)hydrazine hydrochloride 95%, (2,4-Dimethoxybenzyl)hydrazine hydrochloride, 95%, 95%, (2,4-Dimethoxybenzyl)hydrazine hydrochloride, 96%. Offered by: Combi-blocks, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 0,5g, 100mg, 10g.

Structural formula: {0} (CAS {1})

(2,4-dimethoxyphenyl)methylhydrazine;hydrochloride (CAS 462059-71-8) is a chemical compound with the molecular formula C9H15ClN2O2 and a molecular weight of 218.68 g/mol. IUPAC name: (2,4-dimethoxyphenyl)methylhydrazine;hydrochloride. InChIKey: JCIAZIMKVLPKFW-UHFFFAOYSA-N.

Identity
Molecular formulaC9H15ClN2O2
Molecular weight218.68 g/mol
IUPAC name(2,4-dimethoxyphenyl)methylhydrazine;hydrochloride
InChIKeyJCIAZIMKVLPKFW-UHFFFAOYSA-N
SMILESCOC1=CC(=C(C=C1)CNN)OC.Cl

Computed by PubChem (NCBI)