(2,4-Dimethylphenyl)(fluoromethyl)(phenyl)sulfonium tetrafluoroborate, 95%
cas: 2598015-63-3 — see every product listed under this CAS number, including other names
(2,4-Dimethylphenyl)(fluoromethyl)(phenyl)sulfonium tetrafluoroborate, 95% (CAS 2598015-63-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 100mg. Offered by: Ambeed, BLDpharm, Chemat, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A1717789-250mg |
| cas | 2598015-63-3 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 1138.00 Pln | |
| Ambeed | 1g | 3440.88 Pln | |
| Ambeed | 5g | 13136.31 Pln | |
| Ambeed | 10g | 21902.81 Pln | |
| BLDpharm | 100mg | 692.00 Pln | |
| BLDpharm | 250mg | 1119.63 Pln | |
| BLDpharm | 1g | 3374.39 Pln | |
| BLDpharm | 5g | 12882.16 Pln | |
| BLDpharm | 10g | 21473.57 Pln | |
| Chemat | 100mg | 419.60 Pln | |
| Chemat | 250mg | 674.00 Pln | |
| Chemat | 1g | 1845.20 Pln | |
| Chemat | 5g | 7403.60 Pln | |
| Chemat | 10g | 10120.40 Pln | |
| Fluorochem | 100mg | 679.99 Pln | |
| Fluorochem | 250mg | 1091.30 Pln | |
| Fluorochem | 1g | 3241.58 Pln | |
| Fluorochem | 5g | 12019.74 Pln | |
| Fluorochem | 10g | 20037.75 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
(2,4-dimethylphenyl)-(fluoromethyl)-phenylsulfanium tetrafluoroborate (CAS 2598015-63-3) is a chemical compound with the molecular formula C15H16BF5S and a molecular weight of 334.2 g/mol. IUPAC name: (2,4-dimethylphenyl)-(fluoromethyl)-phenylsulfanium tetrafluoroborate. InChIKey: DUJDEUJVTVLBGA-UHFFFAOYSA-N.
| Molecular formula | C15H16BF5S |
|---|---|
| Molecular weight | 334.2 g/mol |
| IUPAC name | (2,4-dimethylphenyl)-(fluoromethyl)-phenylsulfanium tetrafluoroborate |
| InChIKey | DUJDEUJVTVLBGA-UHFFFAOYSA-N |
| SMILES | [B-](F)(F)(F)F.CC1=CC(=C(C=C1)[S+](CF)C2=CC=CC=C2)C |
Computed by PubChem (NCBI)
Synonyms:
(2,4-Dimethylphenyl)(fluoromethyl)(phenyl)sulfonium tetrafluoroborate, (2,4-dimethylphenyl)(fluoromethyl)phenylsulfanium; tetrafluoroboranuide, (2,4-dimethylphenyl)-(fluoromethyl)-phenyl-sulfonium;tetrafluoroborate, (2,4-dimethylphenyl)-(fluoromethyl)-phenylsulfanium;tetrafluoroborate, Sulfonium, (2,4-dimethylphenyl)(fluoromethyl)phenyl-, tetrafluoroborate