CAS 1817632-37-3 is the registry number for (3-Fluoropropyl)diphenylsulfonium tetrafluoroborate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-fluoropropyl(diphenyl)sulfanium tetrafluoroborate (CAS 1817632-37-3) is a chemical compound with the molecular formula C15H16BF5S and a molecular weight of 334.2 g/mol. IUPAC name: 3-fluoropropyl(diphenyl)sulfanium tetrafluoroborate. InChIKey: KKNQQPWJKYATFP-UHFFFAOYSA-N.
| Molecular formula | C15H16BF5S |
|---|---|
| Molecular weight | 334.2 g/mol |
| IUPAC name | 3-fluoropropyl(diphenyl)sulfanium tetrafluoroborate |
| InChIKey | KKNQQPWJKYATFP-UHFFFAOYSA-N |
| SMILES | [B-](F)(F)(F)F.C1=CC=C(C=C1)[S+](CCCF)C2=CC=CC=C2 |
Computed by PubChem (NCBI)