CAS 2598015-63-3 appears in our catalog under these names: (2,4-Dimethylphenyl)(fluoromethyl)(phenyl)sulfonium tetrafluoroborate, 95%, 95%, (2,4-Dimethylphenyl)(fluoromethyl)(phenyl)sulfonium tetrafluoroborate, 95%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g.
(2,4-dimethylphenyl)-(fluoromethyl)-phenylsulfanium tetrafluoroborate (CAS 2598015-63-3) is a chemical compound with the molecular formula C15H16BF5S and a molecular weight of 334.2 g/mol. IUPAC name: (2,4-dimethylphenyl)-(fluoromethyl)-phenylsulfanium tetrafluoroborate. InChIKey: DUJDEUJVTVLBGA-UHFFFAOYSA-N.
| Molecular formula | C15H16BF5S |
|---|---|
| Molecular weight | 334.2 g/mol |
| IUPAC name | (2,4-dimethylphenyl)-(fluoromethyl)-phenylsulfanium tetrafluoroborate |
| InChIKey | DUJDEUJVTVLBGA-UHFFFAOYSA-N |
| SMILES | [B-](F)(F)(F)F.CC1=CC(=C(C=C1)[S+](CF)C2=CC=CC=C2)C |
Computed by PubChem (NCBI)