cas: 2096339-92-1 — see every product listed under this CAS number, including other names
(2,6-Bis(benzyloxy)pyridin-3-yl)boronic acid, 98% (CAS 2096339-92-1) is a chemical reagent available from Chemat. Available pack sizes: 50g, 100mg, 250mg, 500mg, 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F621498-50G |
| cas | 2096339-92-1 |
| size | 50g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 50g | 2387.72 Pln | |
| Fluorochem | 100mg | 122.89 Pln | |
| Fluorochem | 250mg | 159.34 Pln | |
| Fluorochem | 500mg | 190.58 Pln | |
| Fluorochem | 1g | 247.85 Pln | |
| Fluorochem | 5g | 534.20 Pln | |
| Fluorochem | 10g | 763.29 Pln | |
| Fluorochem | 25g | 1221.46 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
[2,6-bis(phenylmethoxy)-3-pyridinyl]boronic acid (CAS 2096339-92-1) is a chemical compound with the molecular formula C19H18BNO4 and a molecular weight of 335.2 g/mol. IUPAC name: [2,6-bis(phenylmethoxy)-3-pyridinyl]boronic acid. InChIKey: KWEZFPLDOCKBPB-UHFFFAOYSA-N.
| Molecular formula | C19H18BNO4 |
|---|---|
| Molecular weight | 335.2 g/mol |
| IUPAC name | [2,6-bis(phenylmethoxy)-3-pyridinyl]boronic acid |
| InChIKey | KWEZFPLDOCKBPB-UHFFFAOYSA-N |
| SMILES | B(C1=C(N=C(C=C1)OCC2=CC=CC=C2)OCC3=CC=CC=C3)(O)O |
Computed by PubChem (NCBI)