CAS 2096339-92-1 appears in our catalog under these names: 2,6-Bis(benzyloxy)pyridine-3-boronic acid, 98%, 2,6-Bis(benzyloxy)pyridine-3-boronic acid, 2,6-Bis(benzyloxy)pyridine-3-boronic acid 98%, 2,6-Bis(benzyloxy)pyridine-3-boronic acid, 98%, 98%, (2,6-Bis(benzyloxy)pyridin-3-yl)boronic acid, 98%. Offered by: Combi-blocks, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 250mg, 10g, 25g, 50g, 100mg, 500mg.
[2,6-bis(phenylmethoxy)-3-pyridinyl]boronic acid (CAS 2096339-92-1) is a chemical compound with the molecular formula C19H18BNO4 and a molecular weight of 335.2 g/mol. IUPAC name: [2,6-bis(phenylmethoxy)-3-pyridinyl]boronic acid. InChIKey: KWEZFPLDOCKBPB-UHFFFAOYSA-N.
| Molecular formula | C19H18BNO4 |
|---|---|
| Molecular weight | 335.2 g/mol |
| IUPAC name | [2,6-bis(phenylmethoxy)-3-pyridinyl]boronic acid |
| InChIKey | KWEZFPLDOCKBPB-UHFFFAOYSA-N |
| SMILES | B(C1=C(N=C(C=C1)OCC2=CC=CC=C2)OCC3=CC=CC=C3)(O)O |
Computed by PubChem (NCBI)