cas: 2096339-92-1 — see every product listed under this CAS number, including other names
2,6-Bis(benzyloxy)pyridine-3-boronic acid, 98%, 98% (CAS 2096339-92-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g, 25g, 50g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12EHIY-100mg |
| cas | 2096339-92-1 |
| size | 100mg |
| availability | 10000g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 88.40 Pln | |
| Chemat | 250mg | 112.40 Pln | |
| Chemat | 500mg | 131.60 Pln | |
| Chemat | 1g | 160.40 Pln | |
| Chemat | 5g | 304.40 Pln | |
| Chemat | 10g | 438.80 Pln | |
| Chemat | 25g | 611.60 Pln | |
| Chemat | 50g | 1029.20 Pln | |
| Chemat | 100g | 1715.60 Pln | |
| Chemat | 250g | 3165.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
[2,6-bis(phenylmethoxy)-3-pyridinyl]boronic acid (CAS 2096339-92-1) is a chemical compound with the molecular formula C19H18BNO4 and a molecular weight of 335.2 g/mol. IUPAC name: [2,6-bis(phenylmethoxy)-3-pyridinyl]boronic acid. InChIKey: KWEZFPLDOCKBPB-UHFFFAOYSA-N.
| Molecular formula | C19H18BNO4 |
|---|---|
| Molecular weight | 335.2 g/mol |
| IUPAC name | [2,6-bis(phenylmethoxy)-3-pyridinyl]boronic acid |
| InChIKey | KWEZFPLDOCKBPB-UHFFFAOYSA-N |
| SMILES | B(C1=C(N=C(C=C1)OCC2=CC=CC=C2)OCC3=CC=CC=C3)(O)O |
Computed by PubChem (NCBI)