cas: 957060-90-1 — see every product listed under this CAS number, including other names
(2-(2,2,2-Trifluoroethoxy)phenyl)boronic acid 98% (CAS 957060-90-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A275474-100mg |
| cas | 957060-90-1 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 203.50 Pln | |
| Ambeed | 250mg | 281.38 Pln | |
| Ambeed | 1g | 409.31 Pln | |
| Ambeed | 5g | 1354.94 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A275474 |
[2-(2,2,2-trifluoroethoxy)phenyl]boronic acid (CAS 957060-90-1) is a chemical compound with the molecular formula C8H8BF3O3 and a molecular weight of 219.96 g/mol. IUPAC name: [2-(2,2,2-trifluoroethoxy)phenyl]boronic acid. InChIKey: IFWDRBWGMUCFMH-UHFFFAOYSA-N.
| Molecular formula | C8H8BF3O3 |
|---|---|
| Molecular weight | 219.96 g/mol |
| IUPAC name | [2-(2,2,2-trifluoroethoxy)phenyl]boronic acid |
| InChIKey | IFWDRBWGMUCFMH-UHFFFAOYSA-N |
| SMILES | B(C1=CC=CC=C1OCC(F)(F)F)(O)O |
Computed by PubChem (NCBI)