cas: 957060-90-1 — see every product listed under this CAS number, including other names
(2-(2,2,2-Trifluoroethoxy)phenyl)boronic acid, 98% (CAS 957060-90-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F619468-250MG |
| cas | 957060-90-1 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 388.42 Pln | |
| Fluorochem | 1g | 888.25 Pln | |
| Fluorochem | 5g | 2918.78 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
[2-(2,2,2-trifluoroethoxy)phenyl]boronic acid (CAS 957060-90-1) is a chemical compound with the molecular formula C8H8BF3O3 and a molecular weight of 219.96 g/mol. IUPAC name: [2-(2,2,2-trifluoroethoxy)phenyl]boronic acid. InChIKey: IFWDRBWGMUCFMH-UHFFFAOYSA-N.
| Molecular formula | C8H8BF3O3 |
|---|---|
| Molecular weight | 219.96 g/mol |
| IUPAC name | [2-(2,2,2-trifluoroethoxy)phenyl]boronic acid |
| InChIKey | IFWDRBWGMUCFMH-UHFFFAOYSA-N |
| SMILES | B(C1=CC=CC=C1OCC(F)(F)F)(O)O |
Computed by PubChem (NCBI)