Products 932390-39-1
CAS 932390-39-1 appears in our catalog under these names: 4-(Hydroxymethyl)-3-(trifluoromethyl)phenylboronic acid, 95%, (4-(Hydroxymethyl)-3-(trifluoromethyl)phenyl)boronic acid, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 5g, 25g, 1g, 250mg.
[4-(hydroxymethyl)-3-(trifluoromethyl)phenyl]boronic acid (CAS 932390-39-1) is a chemical compound with the molecular formula C8H8BF3O3 and a molecular weight of 219.96 g/mol. IUPAC name: [4-(hydroxymethyl)-3-(trifluoromethyl)phenyl]boronic acid. InChIKey: JOMSLFNOGULATK-UHFFFAOYSA-N.
| Molecular formula | C8H8BF3O3 |
|---|---|
| Molecular weight | 219.96 g/mol |
| IUPAC name | [4-(hydroxymethyl)-3-(trifluoromethyl)phenyl]boronic acid |
| InChIKey | JOMSLFNOGULATK-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1)CO)C(F)(F)F)(O)O |
Computed by PubChem (NCBI)