cas: 937273-30-8 — see every product listed under this CAS number, including other names
(2-(2-Chloroethoxy)-5-nitrophenyl)methanol, ≥95%, ≥95% (CAS 937273-30-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11H2KB-100mg |
| cas | 937273-30-8 |
| size | 100mg |
| availability | 25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 568.40 Pln | |
| Chemat | 250mg | 722.00 Pln | |
| Chemat | 1g | 1715.60 Pln | |
| Chemat | 5g | 5920.40 Pln |
| purity | ≥95% |
|---|---|
| delivery time | 3 weeks |
[2-(2-chloroethoxy)-5-nitrophenyl]methanol (CAS 937273-30-8) is a chemical compound with the molecular formula C9H10ClNO4 and a molecular weight of 231.63 g/mol. IUPAC name: [2-(2-chloroethoxy)-5-nitrophenyl]methanol. InChIKey: LUQGPOJLYPDIGI-UHFFFAOYSA-N.
| Molecular formula | C9H10ClNO4 |
|---|---|
| Molecular weight | 231.63 g/mol |
| IUPAC name | [2-(2-chloroethoxy)-5-nitrophenyl]methanol |
| InChIKey | LUQGPOJLYPDIGI-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1[N+](=O)[O-])CO)OCCCl |
Computed by PubChem (NCBI)