Products 156143-87-2

CAS 156143-87-2 appears in our catalog under these names: 3-[Amino(carboxy)methyl]benzoic acid hydrochloride, 95%, 3-(Amino(carboxy)methyl)benzoic acid hydrochloride, 95%, 3-(Amino(carboxy)methyl)benzoic acid hydrochloride. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 250mg, 0,5g, 50mg.

Structural formula: {0} (CAS {1})

3-[amino(carboxy)methyl]benzoic acid;hydrochloride (CAS 156143-87-2) is a chemical compound with the molecular formula C9H10ClNO4 and a molecular weight of 231.63 g/mol. IUPAC name: 3-[amino(carboxy)methyl]benzoic acid;hydrochloride. InChIKey: QEYZDMJQWUJFFS-UHFFFAOYSA-N.

Identity
Molecular formulaC9H10ClNO4
Molecular weight231.63 g/mol
IUPAC name3-[amino(carboxy)methyl]benzoic acid;hydrochloride
InChIKeyQEYZDMJQWUJFFS-UHFFFAOYSA-N
SMILESC1=CC(=CC(=C1)C(=O)O)C(C(=O)O)N.Cl

Computed by PubChem (NCBI)