Products 156143-87-2
CAS 156143-87-2 appears in our catalog under these names: 3-[Amino(carboxy)methyl]benzoic acid hydrochloride, 95%, 3-(Amino(carboxy)methyl)benzoic acid hydrochloride, 95%, 3-(Amino(carboxy)methyl)benzoic acid hydrochloride. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 250mg, 0,5g, 50mg.
3-[Amino(carboxy)methyl]benzoic acid hydrochloride, 95%
Combi-blocks- size: 5g, 1g, 250mg
- Variants: 3
3-[amino(carboxy)methyl]benzoic acid;hydrochloride (CAS 156143-87-2) is a chemical compound with the molecular formula C9H10ClNO4 and a molecular weight of 231.63 g/mol. IUPAC name: 3-[amino(carboxy)methyl]benzoic acid;hydrochloride. InChIKey: QEYZDMJQWUJFFS-UHFFFAOYSA-N.
| Molecular formula | C9H10ClNO4 |
|---|---|
| Molecular weight | 231.63 g/mol |
| IUPAC name | 3-[amino(carboxy)methyl]benzoic acid;hydrochloride |
| InChIKey | QEYZDMJQWUJFFS-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)C(=O)O)C(C(=O)O)N.Cl |
Computed by PubChem (NCBI)