Products 311310-97-1
CAS 311310-97-1 appears in our catalog under these names: 2-Amino-6-(methoxycarbonyl)benzoic acid hydrochloride, 97%, 97%, 2-Amino-6-(methoxycarbonyl)benzoic acid hydrochloride, 95%, 2–Amino–6–(methoxycarbonyl)benzoic Acid Hydrochloride, 2-Amino-6-(methoxycarbonyl)benzoic acid hydrochloride 97%, 2-AMINO-6-(METHOXYCARBONYL)BENZOIC ACID HCL, 97%. Offered by: Chemat, Combi-blocks, GLPBio, Ambeed, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g, 10g, 100g.
2-amino-6-methoxycarbonylbenzoic acid;hydrochloride (CAS 311310-97-1) is a chemical compound with the molecular formula C9H10ClNO4 and a molecular weight of 231.63 g/mol. IUPAC name: 2-amino-6-methoxycarbonylbenzoic acid;hydrochloride. InChIKey: VDKKHVAEYCYZSU-UHFFFAOYSA-N.
| Molecular formula | C9H10ClNO4 |
|---|---|
| Molecular weight | 231.63 g/mol |
| IUPAC name | 2-amino-6-methoxycarbonylbenzoic acid;hydrochloride |
| InChIKey | VDKKHVAEYCYZSU-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C(=CC=C1)N)C(=O)O.Cl |
Computed by PubChem (NCBI)