cas: 690632-12-3 — see every product listed under this CAS number, including other names
(2-(3-Chlorophenyl)thiazol-4-yl)methanamine hydrochloride hydrate, 96% (CAS 690632-12-3) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A496304-1g |
| cas | 690632-12-3 |
| size | 1g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 1g | 1677.97 Pln | |
| AmBeed | 5g | 4900.42 Pln |
| purity | 96% |
|---|---|
| delivery time | To be confirmed by Chemat |
[2-(3-chlorophenyl)-1,3-thiazol-4-yl]methanamine;hydrochloride (CAS 690632-12-3) is a chemical compound with the molecular formula C10H10Cl2N2S and a molecular weight of 261.17 g/mol. IUPAC name: [2-(3-chlorophenyl)-1,3-thiazol-4-yl]methanamine;hydrochloride. InChIKey: DBEFCUHDXFEPSJ-UHFFFAOYSA-N.
| Molecular formula | C10H10Cl2N2S |
|---|---|
| Molecular weight | 261.17 g/mol |
| IUPAC name | [2-(3-chlorophenyl)-1,3-thiazol-4-yl]methanamine;hydrochloride |
| InChIKey | DBEFCUHDXFEPSJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Cl)C2=NC(=CS2)CN.Cl |
Computed by PubChem (NCBI)