cas: 690632-12-3 — see every product listed under this CAS number, including other names
[2-(3-Chlorophenyl)-1,3-thiazol-4-yl]methanamine hydrochloride monohydrate, 97% (CAS 690632-12-3) is a chemical reagent available from Chemat. Available pack sizes: 250MG, 1g, 5g. Offered by: Thermo Scientific.
| brand | Thermo Scientific |
|---|---|
| catalog number | MO01298CB |
| cas | 690632-12-3 |
| size | 250MG |
| brand | size | price | |
|---|---|---|---|
| Thermo Scientific | 250MG | 462.24 Pln | |
| Thermo Scientific | 1g | 1282.88 Pln | |
| Thermo Scientific | 5g | 4617.36 Pln |
| delivery time | 2-3 weeks |
|---|---|
| category | Chemicals |
| purity | 97% |
[2-(3-chlorophenyl)-1,3-thiazol-4-yl]methanamine;hydrochloride (CAS 690632-12-3) is a chemical compound with the molecular formula C10H10Cl2N2S and a molecular weight of 261.17 g/mol. IUPAC name: [2-(3-chlorophenyl)-1,3-thiazol-4-yl]methanamine;hydrochloride. InChIKey: DBEFCUHDXFEPSJ-UHFFFAOYSA-N.
| Molecular formula | C10H10Cl2N2S |
|---|---|
| Molecular weight | 261.17 g/mol |
| IUPAC name | [2-(3-chlorophenyl)-1,3-thiazol-4-yl]methanamine;hydrochloride |
| InChIKey | DBEFCUHDXFEPSJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Cl)C2=NC(=CS2)CN.Cl |
Computed by PubChem (NCBI)