Products 125022-67-5
CAS 125022-67-5 is the registry number for (3,4-Dichloro-phenyl)-(5,6-dihydro-4h-[1,3]thiazin-2-yl)-amine, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 250mg, 1g, 100mg.
N-(3,4-dichlorophenyl)-5,6-dihydro-4H-1,3-thiazin-2-amine (CAS 125022-67-5) is a chemical compound with the molecular formula C10H10Cl2N2S and a molecular weight of 261.17 g/mol. IUPAC name: N-(3,4-dichlorophenyl)-5,6-dihydro-4H-1,3-thiazin-2-amine. InChIKey: CXSKSYHKTWRGRM-UHFFFAOYSA-N.
| Molecular formula | C10H10Cl2N2S |
|---|---|
| Molecular weight | 261.17 g/mol |
| IUPAC name | N-(3,4-dichlorophenyl)-5,6-dihydro-4H-1,3-thiazin-2-amine |
| InChIKey | CXSKSYHKTWRGRM-UHFFFAOYSA-N |
| SMILES | C1CN=C(SC1)NC2=CC(=C(C=C2)Cl)Cl |
Computed by PubChem (NCBI)